cas: 58484-01-8 — see every product listed under this CAS number, including other names
3-Amino-2,6-dichloroisonicotinic acid, 97% (CAS 58484-01-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318526-1G |
| cas | 58484-01-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 815.36 Pln | |
| Fluorochem | 10g | 1528.65 Pln | |
| Fluorochem | 25g | 3101.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-2,6-dichloropyridine-4-carboxylic acid (CAS 58484-01-8) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 3-amino-2,6-dichloropyridine-4-carboxylic acid. InChIKey: VKPLOTZPQFRWQP-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3-amino-2,6-dichloropyridine-4-carboxylic acid |
| InChIKey | VKPLOTZPQFRWQP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)