cas: 16951-33-0 — see every product listed under this CAS number, including other names
3-Amino-2-mercapto-3 H -quinazolin-4-one, 95% (CAS 16951-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F026577-250MG |
| cas | 16951-33-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1533.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-2-sulfanylidene-1H-quinazolin-4-one (CAS 16951-33-0) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 3-amino-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: FRPVOZIFQMSLTJ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 3-amino-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | FRPVOZIFQMSLTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=S)N2)N |
Computed by PubChem (NCBI)