cas: 180263-44-9 — see every product listed under this CAS number, including other names
3-Amino-3-(4-(trifluoromethyl)phenyl)propanoic acid, 98%, 98% (CAS 180263-44-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132UJ-250mg |
| cas | 180263-44-9 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 180263-44-9) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: ABDRZHVLIRZFQO-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | ABDRZHVLIRZFQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)