CAS 3832-73-3 appears in our catalog under these names: 2–Amino–3–(2–(trifluoromethyl)phenyl)propanoic acid, 2-(Trifluoromethyl)-dl-phenylalanine, 95%, 2-(Trifluoromethyl)-dl-phenylalanine, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g.
2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 3832-73-3) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: IOABLDGLYOGEHY-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | IOABLDGLYOGEHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)