CAS 119009-47-1 appears in our catalog under these names: L-2-Trifluoromethylphenylalanine, 98%, 2–(Trifluoromethyl)–L–phenylalanine, H-L-Phe(2-CF3)-OH, (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid, 95%, 95%, (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid, 99.36%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 250mg, 1 g, 5 g, 10g.
(2S)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 119009-47-1) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: (2S)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: IOABLDGLYOGEHY-QMMMGPOBSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | (2S)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | IOABLDGLYOGEHY-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)