CAS 180263-44-9 appears in our catalog under these names: 3-Amino-3-[4-(trifluoromethyl)phenyl]propanoic acid, 97%, H-β-DL-Phe(4-CF3)-OH 98%, 3-Amino-3-(4-(trifluoromethyl)phenyl)propanoic acid, 98%, 98%, 3-(P-TRIFLUOROMETHYLPHENYL)-DL-BETA-ALANINE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 50g.
3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 180263-44-9) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: ABDRZHVLIRZFQO-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | ABDRZHVLIRZFQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)