CAS 755749-11-2 appears in our catalog under these names: (S)-3-Amino-3-(2-trifluoromethyl-phenyl)-propionic acid, 95%, (S)-3-AMINO-3-(2-(TRIFLUOROMETHYL)PHENYL)PROPANOIC ACID, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
(3S)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 755749-11-2) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: (3S)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: MXKROQQTKYAUJB-QMMMGPOBSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | (3S)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | MXKROQQTKYAUJB-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CC(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)