CAS 116332-62-8 is the registry number for N-Methoxy-n-methyl-3-(trifluoromethyl)benzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
N-methoxy-N-methyl-3-(trifluoromethyl)benzamide (CAS 116332-62-8) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: N-methoxy-N-methyl-3-(trifluoromethyl)benzamide. InChIKey: PAXXRRIUUCZPEU-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | N-methoxy-N-methyl-3-(trifluoromethyl)benzamide |
| InChIKey | PAXXRRIUUCZPEU-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=CC=C1)C(F)(F)F)OC |
Computed by PubChem (NCBI)