CAS 400749-02-2 appears in our catalog under these names: 3'–(Trifluoromethyl)–(1,1'–biphenyl)–3–amine, 3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-amine, 95%, 95%, 3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-amine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-[3-(trifluoromethyl)phenyl]aniline (CAS 400749-02-2) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]aniline. InChIKey: STZPUMRJVDKRJE-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]aniline |
| InChIKey | STZPUMRJVDKRJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)