CAS 57688-34-3 appears in our catalog under these names: 4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine, 98%, 98%, 4'-Trifluoromethylbiphenyl-4-ylamine, 95%, 4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[4-(trifluoromethyl)phenyl]aniline (CAS 57688-34-3) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]aniline. InChIKey: PDKIAMYXBRKPBW-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | PDKIAMYXBRKPBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)