CAS 400744-68-5 is the registry number for 2'-Trifluoromethyl-biphenyl-3-ylamine, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
3-[2-(trifluoromethyl)phenyl]aniline (CAS 400744-68-5) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 3-[2-(trifluoromethyl)phenyl]aniline. InChIKey: FURVGDHXNLLLLU-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-[2-(trifluoromethyl)phenyl]aniline |
| InChIKey | FURVGDHXNLLLLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)