CAS 209917-92-0 appears in our catalog under these names: 2'-(Trifluoromethyl)-(1,1'-biphenyl)-4-amine, 95%, 2'-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
4-[2-(trifluoromethyl)phenyl]aniline (CAS 209917-92-0) is a chemical compound with the molecular formula C13H10F3N and a molecular weight of 237.22 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]aniline. InChIKey: FEGMGXJJEHFDQO-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]aniline |
| InChIKey | FEGMGXJJEHFDQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)