cas: 131508-15-1 — see every product listed under this CAS number, including other names
3-Amino-4-Nitrobenzamide, 98% (CAS 131508-15-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A437659-5g |
| cas | 131508-15-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8448.37 Pln | |
| AmBeed | 10g | 13610.80 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-4-nitrobenzamide (CAS 131508-15-1) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-amino-4-nitrobenzamide. InChIKey: VIPAFEMXGAOTSV-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-amino-4-nitrobenzamide |
| InChIKey | VIPAFEMXGAOTSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)