cas: 394735-23-0 — see every product listed under this CAS number, including other names
3-Amino-4-cyclobutyl-2-hydroxybutanamide hydrochloride 98% (CAS 394735-23-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140922-250mg |
| cas | 394735-23-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A140922 |
3-amino-4-cyclobutyl-2-hydroxybutanamide;hydrochloride (CAS 394735-23-0) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: 3-amino-4-cyclobutyl-2-hydroxybutanamide;hydrochloride. InChIKey: RPOOMVSVQPMDGI-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 3-amino-4-cyclobutyl-2-hydroxybutanamide;hydrochloride |
| InChIKey | RPOOMVSVQPMDGI-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CC(C(C(=O)N)O)N.Cl |
Computed by PubChem (NCBI)