Products 955027-89-1

CAS 955027-89-1 is the registry number for Ethyl-carbamic acid piperidin-4-yl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Piperidin-4-yl N-ethylcarbamate;hydrochloride (CAS 955027-89-1) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: piperidin-4-yl N-ethylcarbamate;hydrochloride. InChIKey: HUTYDZJMLPYJCM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O2
Molecular weight208.68 g/mol
IUPAC namepiperidin-4-yl N-ethylcarbamate;hydrochloride
InChIKeyHUTYDZJMLPYJCM-UHFFFAOYSA-N
SMILESCCNC(=O)OC1CCNCC1.Cl

Computed by PubChem (NCBI)