cas: 116378-40-6 — see every product listed under this CAS number, including other names
3-Amino-5-boronobenzoic acid 98% (CAS 116378-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737812-100mg |
| cas | 116378-40-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A737812 |
3-amino-5-boronobenzoic acid (CAS 116378-40-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: 3-amino-5-boronobenzoic acid. InChIKey: VVQAAMZMJNXCOP-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | 3-amino-5-boronobenzoic acid |
| InChIKey | VVQAAMZMJNXCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)O)(O)O |
Computed by PubChem (NCBI)