cas: 116378-40-6 — see every product listed under this CAS number, including other names
3–Amino–5–carboxylphenylboronic acid(contains varying amounts of Anhydride) (CAS 116378-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD01327-1g |
| cas | 116378-40-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 924.67 Pln | |
| GLPBio | 250mg | 737.45 Pln | |
| GLPBio | 5g | 2455.20 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-5-boronobenzoic acid (CAS 116378-40-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: 3-amino-5-boronobenzoic acid. InChIKey: VVQAAMZMJNXCOP-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | 3-amino-5-boronobenzoic acid |
| InChIKey | VVQAAMZMJNXCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)O)(O)O |
Computed by PubChem (NCBI)