cas: 116378-40-6 — see every product listed under this CAS number, including other names
3-Amino-5-boronobenzoic acid, 97% (CAS 116378-40-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209856-250MG |
| cas | 116378-40-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1445.34 Pln | |
| Fluorochem | 10g | 2840.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-5-boronobenzoic acid (CAS 116378-40-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: 3-amino-5-boronobenzoic acid. InChIKey: VVQAAMZMJNXCOP-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | 3-amino-5-boronobenzoic acid |
| InChIKey | VVQAAMZMJNXCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)O)(O)O |
Computed by PubChem (NCBI)