cas: 116632-33-8 — see every product listed under this CAS number, including other names
3-BROMO-5-NITROQUINOLINE, 95% (CAS 116632-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F466932-250MG |
| cas | 116632-33-8 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1143.37 Pln | |
| Fluorochem | 25g | 2210.70 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1104.63 Pln | |
| Ambeed | 25g | 2150.38 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-bromo-5-nitroquinoline (CAS 116632-33-8) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-5-nitroquinoline. InChIKey: VBGNJJXCTAWOIU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-5-nitroquinoline |
| InChIKey | VBGNJJXCTAWOIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)