cas: 116632-33-8 — see every product listed under this CAS number, including other names
3-Bromo-5-nitroquinoline, 95%, 95% (CAS 116632-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CX0-100mg |
| cas | 116632-33-8 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1571.60 Pln | |
| Chemat | 50g | 3059.60 Pln | |
| Chemat | 100g | 5987.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-nitroquinoline (CAS 116632-33-8) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 3-bromo-5-nitroquinoline. InChIKey: VBGNJJXCTAWOIU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 3-bromo-5-nitroquinoline |
| InChIKey | VBGNJJXCTAWOIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Br)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)