cas: 870718-07-3 — see every product listed under this CAS number, including other names
3-Benzyloxy-2,6-difluorophenylboronic acid 98% (CAS 870718-07-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179707-250mg |
| cas | 870718-07-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A179707 |
(2,6-difluoro-3-phenylmethoxyphenyl)boronic acid (CAS 870718-07-3) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid. InChIKey: MUKMMBLTLNKOAC-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | MUKMMBLTLNKOAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)