Products 2377587-48-7

CAS 2377587-48-7 is the registry number for 4-Fluoro-3-[(3-fluorophenyl)(hydroxy)methyl]phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenyl]boronic acid (CAS 2377587-48-7) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenyl]boronic acid. InChIKey: AYQBUNWWASKYER-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BF2O3
Molecular weight264.03 g/mol
IUPAC name[4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenyl]boronic acid
InChIKeyAYQBUNWWASKYER-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)F)C(C2=CC(=CC=C2)F)O)(O)O

Computed by PubChem (NCBI)