CAS 156635-89-1 appears in our catalog under these names: 4-Benzyloxy-2,6-difluorophenylboronic acid, 98%, 4-Benzyloxy-2,6-difluorophenylboronic acid, 97%, 97%, (4-(Benzyloxy)-2,6-difluorophenyl)boronic acid, 97%, (4-(Benzyloxy)-2,6-difluorophenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(2,6-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-89-1) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: CDIXTACVWOYKES-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | CDIXTACVWOYKES-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)