CAS 2246544-61-4 appears in our catalog under these names: {4–((2,6–difluorophenyl)methoxy)phenyl}boronic acid, (4-((2,6-Difluorobenzyl)oxy)phenyl)boronic acid, 95%, (4-((2,6-Difluorobenzyl)oxy)phenyl)boronic acid, 98%, (4-((2,6-Difluorobenzyl)oxy)phenyl)boronic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
[4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid (CAS 2246544-61-4) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid. InChIKey: MVUGISHBPKVKES-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | MVUGISHBPKVKES-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=C(C=CC=C2F)F)(O)O |
Computed by PubChem (NCBI)