Products 2377587-42-1
CAS 2377587-42-1 appears in our catalog under these names: 4-Fluoro-3-[(4-fluorophenyl)(hydroxy)methyl]phenylboronic acid, 97%, (4-Fluoro-3-((4-fluorophenyl)(hydroxy)methyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-fluoro-3-[(4-fluorophenyl)-hydroxymethyl]phenyl]boronic acid (CAS 2377587-42-1) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [4-fluoro-3-[(4-fluorophenyl)-hydroxymethyl]phenyl]boronic acid. InChIKey: GJXPMKNGWBKISH-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [4-fluoro-3-[(4-fluorophenyl)-hydroxymethyl]phenyl]boronic acid |
| InChIKey | GJXPMKNGWBKISH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(C2=CC=C(C=C2)F)O)(O)O |
Computed by PubChem (NCBI)