CAS 1150114-56-9 appears in our catalog under these names: 2-(Benzyloxy)-3,5-difluorophenylboronic acid, 98%, (2-(Benzyloxy)-3,5-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(3,5-difluoro-2-phenylmethoxyphenyl)boronic acid (CAS 1150114-56-9) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (3,5-difluoro-2-phenylmethoxyphenyl)boronic acid. InChIKey: IHFUXROSLRIZDZ-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (3,5-difluoro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | IHFUXROSLRIZDZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)