3-Borono-5-methylbenzoic acid 98%
cas: 1150114-66-1 — see every product listed under this CAS number, including other names
3-Borono-5-methylbenzoic acid 98% (CAS 1150114-66-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112233-5g |
| cas | 1150114-66-1 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 2623.19 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 10g | 4403.19 Pln | |
| Ambeed | 25g | 8725.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A112233 |
3-borono-5-methylbenzoic acid (CAS 1150114-66-1) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 3-borono-5-methylbenzoic acid. InChIKey: LGRLKFHVFRMHOZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 3-borono-5-methylbenzoic acid |
| InChIKey | LGRLKFHVFRMHOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C)(O)O |
Computed by PubChem (NCBI)