Products 499769-88-9
CAS 499769-88-9 appears in our catalog under these names: 1,4-Benzodioxane-5-boronic acid, 98%, (2,3-Dihydrobenzo(b)(1,4)dioxin-5-yl)boronic acid, (2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)boronic acid 95%, 1,4-Benzodioxane-5-boronic acid, 95%, 95%, (2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)boronic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 2g, 500mg.
2,3-dihydro-1,4-benzodioxin-5-ylboronic acid (CAS 499769-88-9) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-5-ylboronic acid. InChIKey: MCWPMXPNJVZOTP-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-5-ylboronic acid |
| InChIKey | MCWPMXPNJVZOTP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCCO2)(O)O |
Computed by PubChem (NCBI)