CAS 1150114-66-1 appears in our catalog under these names: 3-Carboxy-5-methylphenylboronic acid, 98%, 3-Carboxy-5-methylphenylboronic acid, 98%, 98%, 3-Borono-5-methylbenzoic acid, 95%, 3-Borono-5-methylbenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
3-borono-5-methylbenzoic acid (CAS 1150114-66-1) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 3-borono-5-methylbenzoic acid. InChIKey: LGRLKFHVFRMHOZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 3-borono-5-methylbenzoic acid |
| InChIKey | LGRLKFHVFRMHOZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C)(O)O |
Computed by PubChem (NCBI)