CAS 1001108-64-0 appears in our catalog under these names: 2-(Carboxymethyl)phenylboronic acid, 96%, 2-(2-Boronophenyl)acetic acid, 96%, 2-(Carboxymethyl)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g.
2-(2-boronophenyl)acetic acid (CAS 1001108-64-0) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2-(2-boronophenyl)acetic acid. InChIKey: ZWCYROWFNLFPED-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2-(2-boronophenyl)acetic acid |
| InChIKey | ZWCYROWFNLFPED-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CC(=O)O)(O)O |
Computed by PubChem (NCBI)