Products 177490-82-3
CAS 177490-82-3 appears in our catalog under these names: 4-Acetoxyphenylboronic acid, 96%, 4–Acetoxyphenylboronic acid(contains varying amounts of Anhydride), 4-Acetoxyphenylboronic Acid (contains varying amounts of Anhydride), (4-Acetoxyphenyl)boronic acid 98%, (4-Acetoxyphenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 200mg, 250mg.
(4-acetyloxyphenyl)boronic acid (CAS 177490-82-3) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (4-acetyloxyphenyl)boronic acid. InChIKey: VILXJXDXZGKJLU-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (4-acetyloxyphenyl)boronic acid |
| InChIKey | VILXJXDXZGKJLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC(=O)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Acetoxybenzeneboronic acid, 4-Acetoxyphenylboronic acid, (4-Acetoxyphenyl)boronic acid, (4-acetyloxyphenyl)boronic acid, [4-(Acetyloxy)phenyl]boronic acid, Boronic acid, B-[4-(acetyloxy)phenyl]-, Boronic acid, [4-(acetyloxy)phenyl]-, (4-Acetoxyphenyl)boronicacid, 4-Acetyloxyphenylboronic acid, 4-Acetoxyphenylboronic acid(contains varying amounts of Anhydride)