CAS 127972-02-5 appears in our catalog under these names: 5–Formyl–2–methoxyphenylboronic acid, 5-Formyl-2-methoxyphenylboronic acid, 98%, 2-Methoxy-5-formylphenylboronic acid, 97%, (5-Formyl-2-methoxyphenyl)boronic acid, 98%, 5-Formyl-2-methoxyphenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, TCI. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
(5-formyl-2-methoxyphenyl)boronic acid (CAS 127972-02-5) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (5-formyl-2-methoxyphenyl)boronic acid. InChIKey: NKKNXLPHCRLBDY-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (5-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | NKKNXLPHCRLBDY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)OC)(O)O |
Computed by PubChem (NCBI)