cas: 1190314-17-0 — see every product listed under this CAS number, including other names
3-BroMo-7-azaindole-4-carboxylic acid, 97%, 97% (CAS 1190314-17-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HLG-100mg |
| cas | 1190314-17-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 500mg | 520.40 Pln | |
| Chemat | 1g | 746.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid (CAS 1190314-17-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid. InChIKey: DLHZKMNKZGVAEW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid |
| InChIKey | DLHZKMNKZGVAEW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(=O)O)C(=CN2)Br |
Computed by PubChem (NCBI)