cas: 1092351-47-7 — see every product listed under this CAS number, including other names
3-Bromo-1-methyl-1H-indazol-4-amine, 98% (CAS 1092351-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236582-100MG |
| cas | 1092351-47-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1528.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-1-methylindazol-4-amine (CAS 1092351-47-7) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 3-bromo-1-methylindazol-4-amine. InChIKey: KICKKRNPIPGMTR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 3-bromo-1-methylindazol-4-amine |
| InChIKey | KICKKRNPIPGMTR-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC(=C2C(=N1)Br)N |
Computed by PubChem (NCBI)