CAS 499770-76-2 appears in our catalog under these names: 5-(Bromomethyl)-1-methyl-1h-1,2,3-benzotriazole, 98%, 5-(Bromomethyl)-1-methyl-1H-benzo(d)(1,2,3)triazole, 95%, 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole, 95% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 5g, 1g, 250mg.
5-(bromomethyl)-1-methylbenzotriazole (CAS 499770-76-2) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 5-(bromomethyl)-1-methylbenzotriazole. InChIKey: OSUZHHPMRAIJDY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 5-(bromomethyl)-1-methylbenzotriazole |
| InChIKey | OSUZHHPMRAIJDY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)CBr)N=N1 |
Computed by PubChem (NCBI)