cas: 50343-02-7 — see every product listed under this CAS number, including other names
3-Bromo-2-hydroxy-5-methoxybenzaldehyde, 96%, 96% (CAS 50343-02-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UOW-1g |
| cas | 50343-02-7 |
| size | 1g |
| availability | 14.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 10g | 976.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-hydroxy-5-methoxybenzaldehyde (CAS 50343-02-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-2-hydroxy-5-methoxybenzaldehyde. InChIKey: BSLKYCQDKAAGGV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-2-hydroxy-5-methoxybenzaldehyde |
| InChIKey | BSLKYCQDKAAGGV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)O)C=O |
Computed by PubChem (NCBI)