cas: 7138-15-0 — see every product listed under this CAS number, including other names
3-Bromo-2-nitroaniline 98% (CAS 7138-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113957-1g |
| cas | 7138-15-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 1571.88 Pln | |
| Ambeed | 500g | 6578.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A113957 |
3-bromo-2-nitroaniline (CAS 7138-15-0) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-2-nitroaniline. InChIKey: GLKHLBAXHLAQBJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-2-nitroaniline |
| InChIKey | GLKHLBAXHLAQBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)