cas: 76361-99-4 — see every product listed under this CAS number, including other names
3-Bromo-2-nitrophenol, 95%, 95% (CAS 76361-99-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140PN-100mg |
| cas | 76361-99-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 10g | 606.80 Pln | |
| Chemat | 25g | 1360.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-nitrophenol (CAS 76361-99-4) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-2-nitrophenol. InChIKey: AUORDBJGOHYGKR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-2-nitrophenol |
| InChIKey | AUORDBJGOHYGKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])O |
Computed by PubChem (NCBI)