CAS 78137-76-5 appears in our catalog under these names: 4-Bromo-3-nitrophenol, 98%, 4-Bromo-3-nitrophenol 97%, 4-Bromo-3-nitrophenol, 97%, 97%, 4-Bromo-3-nitrophenol, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 500g, 5g, 1g, 10g.
4-bromo-3-nitrophenol (CAS 78137-76-5) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 4-bromo-3-nitrophenol. InChIKey: MTNZLOXGKDQNKA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 4-bromo-3-nitrophenol |
| InChIKey | MTNZLOXGKDQNKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)