CAS 5470-65-5 appears in our catalog under these names: 3-Bromo-4-nitrophenol, 98%, 3-Bromo-4-nitrophenol, 3-Bromo-4-nitrophenol 97%, 3-Bromo-4-nitrophenol, 97%, 97%, 3-Bromo-4-nitrophenol, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.
3-bromo-4-nitrophenol (CAS 5470-65-5) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-4-nitrophenol. InChIKey: SZYVPWPBRABKAB-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-4-nitrophenol |
| InChIKey | SZYVPWPBRABKAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)