Products 1052114-83-6
CAS 1052114-83-6 appears in our catalog under these names: 5-Bromo-4-hydroxynicotinic acid, 95%, 5-Bromo-4-oxo-1,4-dihydropyridine-3-carboxylic acid, 95%, 5-Bromo-4-hydroxynicotinic acid 95%, 5-BroMo-4-hydroxynicotinic acid, 97%, 97%, 5-Bromo-4-hydroxynicotinic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
5-bromo-4-oxo-1H-pyridine-3-carboxylic acid (CAS 1052114-83-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 5-bromo-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: GZZLALVERDWLIO-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 5-bromo-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | GZZLALVERDWLIO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CN1)Br)C(=O)O |
Computed by PubChem (NCBI)