CAS 76361-99-4 appears in our catalog under these names: 3-Bromo-2-nitrophenol, 3-Bromo-2-nitrophenol 95%, 3-Bromo-2-nitrophenol, 95%, 95%, 3-Bromo-2-nitrophenol, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100mg.
3-bromo-2-nitrophenol (CAS 76361-99-4) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-2-nitrophenol. InChIKey: AUORDBJGOHYGKR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-2-nitrophenol |
| InChIKey | AUORDBJGOHYGKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])O |
Computed by PubChem (NCBI)