CAS 5847-59-6 appears in our catalog under these names: 2-Bromo-4-nitrophenol, 98%, 2-Bromo-4-nitrophenol, 2–Bromo–4–nitrophenol, 2-Bromo-4-nitrophenol, >98.0%(GC)(T), 2-Bromo-4-nitrophenol 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 100mg, 250mg, 500mg.
2-bromo-4-nitrophenol (CAS 5847-59-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 2-bromo-4-nitrophenol. InChIKey: DCIPFSYBGTWYCR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 2-bromo-4-nitrophenol |
| InChIKey | DCIPFSYBGTWYCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)O |
Computed by PubChem (NCBI)