cas: 1204810-05-8 — see every product listed under this CAS number, including other names
3-Bromo-4,6-dichloroquinoline, 97%, 97% (CAS 1204810-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110464-100mg |
| cas | 1204810-05-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 909.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4,6-dichloroquinoline (CAS 1204810-05-8) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 3-bromo-4,6-dichloroquinoline. InChIKey: XVIDUYCZZSSQQZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 3-bromo-4,6-dichloroquinoline |
| InChIKey | XVIDUYCZZSSQQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)