CAS 1070879-40-1 appears in our catalog under these names: 4-Bromo-7,8-dichloroquinoline, 95%, 4-Bromo-7,8-dichloroquinoline, 97%, 4-Bromo-7,8-dichloroquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-bromo-7,8-dichloroquinoline (CAS 1070879-40-1) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 4-bromo-7,8-dichloroquinoline. InChIKey: HCKYNTRWPZIEGM-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 4-bromo-7,8-dichloroquinoline |
| InChIKey | HCKYNTRWPZIEGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)Br)Cl)Cl |
Computed by PubChem (NCBI)