CAS 924271-40-9 appears in our catalog under these names: 7-bromo-1,3-dichloroisoquinoline, 97%, 7-Bromo-1,3-dichloroisoquinoline 97%, Isoquinoline, 7-bromo-1,3-dichloro-, 97%, 97%, 7-Bromo-1,3-dichloroisoquinoline, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 10g, 1g, 100g, 100mg.
7-bromo-1,3-dichloroisoquinoline (CAS 924271-40-9) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,3-dichloroisoquinoline. InChIKey: DVPABFNTLVFBQI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,3-dichloroisoquinoline |
| InChIKey | DVPABFNTLVFBQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(N=C(C=C21)Cl)Cl)Br |
Computed by PubChem (NCBI)