CAS 1021435-01-7 appears in our catalog under these names: 7-Bromo-3,4-dichloroquinoline, 95%, 7-Bromo-3,4-dichloroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7-bromo-3,4-dichloroquinoline (CAS 1021435-01-7) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-3,4-dichloroquinoline. InChIKey: HRUWRHDAJXUPON-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-3,4-dichloroquinoline |
| InChIKey | HRUWRHDAJXUPON-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)