CAS 1204810-05-8 appears in our catalog under these names: 3-Bromo-4,6-dichloroquinoline, 95%, 3-Bromo-4,6-dichloroquinoline, 98%, 3-Bromo-4,6-dichloroquinoline, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-bromo-4,6-dichloroquinoline (CAS 1204810-05-8) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 3-bromo-4,6-dichloroquinoline. InChIKey: XVIDUYCZZSSQQZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 3-bromo-4,6-dichloroquinoline |
| InChIKey | XVIDUYCZZSSQQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)