cas: 1204810-05-8 — see every product listed under this CAS number, including other names
3-Bromo-4,6-dichloroquinoline, 98% (CAS 1204810-05-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1162995-5g |
| cas | 1204810-05-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1101.71 Pln | |
| Fluorochem | 5g | 3090.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-4,6-dichloroquinoline (CAS 1204810-05-8) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 3-bromo-4,6-dichloroquinoline. InChIKey: XVIDUYCZZSSQQZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 3-bromo-4,6-dichloroquinoline |
| InChIKey | XVIDUYCZZSSQQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)