cas: 1214385-56-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethyl)phenol 97% (CAS 1214385-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A718150-1g |
| cas | 1214385-56-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1432.81 Pln | |
| Ambeed | 10g | 1710.94 Pln | |
| Ambeed | 25g | 4164.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A718150 |
3-bromo-4-(trifluoromethyl)phenol (CAS 1214385-56-4) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)phenol. InChIKey: YWJMFYOMJODKJY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)phenol |
| InChIKey | YWJMFYOMJODKJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)C(F)(F)F |
Computed by PubChem (NCBI)